CAS 37551-43-2 is the registry number for 5-Chloro-n,2-dihydroxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-chloro-N,2-dihydroxybenzamide (CAS 37551-43-2) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 5-chloro-N,2-dihydroxybenzamide. InChIKey: VGDCRPRQQPVICX-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 5-chloro-N,2-dihydroxybenzamide |
| InChIKey | VGDCRPRQQPVICX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NO)O |
Computed by PubChem (NCBI)