CAS 37552-52-6 appears in our catalog under these names: (2S)–2–Amino–5–(N–hydroxyamino)pentanoic acid hydrochloride, (2S)-2-Amino-5-(N-hydroxyamino)pentanoic acid hydrochloride, H-Orn(OH)-OH HCl 97%, (S)-2-Amino-5-(hydroxyamino)pentanoic acid hydrochloride, 97%, 97%, (2S)-2-amino-5-(N-hydroxyamino)pentanoic acid hydrochloride, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 1g.
(2S)-2-amino-5-(hydroxyamino)pentanoic acid;hydrochloride (CAS 37552-52-6) is a chemical compound with the molecular formula C5H13ClN2O3 and a molecular weight of 184.62 g/mol. IUPAC name: (2S)-2-amino-5-(hydroxyamino)pentanoic acid;hydrochloride. InChIKey: PHLFATUAARYTFP-WCCKRBBISA-N.
| Molecular formula | C5H13ClN2O3 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (2S)-2-amino-5-(hydroxyamino)pentanoic acid;hydrochloride |
| InChIKey | PHLFATUAARYTFP-WCCKRBBISA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CNO.Cl |
Computed by PubChem (NCBI)