CAS 66954-83-4 is the registry number for rac-Erythro-3-hydroxy-DL-ornithine Monohydrochloride. Offered by: TRC. Available pack sizes: 1g.
(2S,3S)-2,5-diamino-3-hydroxypentanoic acid;hydrochloride (CAS 66954-83-4) is a chemical compound with the molecular formula C5H13ClN2O3 and a molecular weight of 184.62 g/mol. IUPAC name: (2S,3S)-2,5-diamino-3-hydroxypentanoic acid;hydrochloride. InChIKey: XFRYPAVXBMFXQE-MMALYQPHSA-N.
| Molecular formula | C5H13ClN2O3 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (2S,3S)-2,5-diamino-3-hydroxypentanoic acid;hydrochloride |
| InChIKey | XFRYPAVXBMFXQE-MMALYQPHSA-N |
| SMILES | C(CN)[C@@H]([C@@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)