Products 37624-71-8

CAS 37624-71-8 is the registry number for N,N',N''-Tri-2-pyridinylphosphoric triamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

N-bis(pyridin-2-ylamino)phosphorylpyridin-2-amine (CAS 37624-71-8) is a chemical compound with the molecular formula C15H15N6OP and a molecular weight of 326.29 g/mol. IUPAC name: N-bis(pyridin-2-ylamino)phosphorylpyridin-2-amine. InChIKey: RGXNYMLWPFBKMK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15N6OP
Molecular weight326.29 g/mol
IUPAC nameN-bis(pyridin-2-ylamino)phosphorylpyridin-2-amine
InChIKeyRGXNYMLWPFBKMK-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)NP(=O)(NC2=CC=CC=N2)NC3=CC=CC=N3

Computed by PubChem (NCBI)