CAS 856801-01-9 is the registry number for N,N',N''–Tris(3–pyridinyl)phosphoric triamide. Offered by: GLPBio. Available pack sizes: 1g.
N-bis(pyridin-3-ylamino)phosphorylpyridin-3-amine (CAS 856801-01-9) is a chemical compound with the molecular formula C15H15N6OP and a molecular weight of 326.29 g/mol. IUPAC name: N-bis(pyridin-3-ylamino)phosphorylpyridin-3-amine. InChIKey: UQXFLVZFHZKYQQ-UHFFFAOYSA-N.
| Molecular formula | C15H15N6OP |
|---|---|
| Molecular weight | 326.29 g/mol |
| IUPAC name | N-bis(pyridin-3-ylamino)phosphorylpyridin-3-amine |
| InChIKey | UQXFLVZFHZKYQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NP(=O)(NC2=CN=CC=C2)NC3=CN=CC=C3 |
Computed by PubChem (NCBI)