CAS 37678-61-8 appears in our catalog under these names: 4,5–Dimethyl–2,3–dihydro–1H–inden–1–one, 4,5-Dimethyl-2,3-dihydro-1H-inden-1-one, 95%, 95%, 4,5-Dimethyl-2,3-dihydro-1H-inden-1-one, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g.
4,5-dimethyl-2,3-dihydroinden-1-one (CAS 37678-61-8) is a chemical compound with the molecular formula C11H12O and a molecular weight of 160.21 g/mol. IUPAC name: 4,5-dimethyl-2,3-dihydroinden-1-one. InChIKey: YMIIQKHQXYRXGP-UHFFFAOYSA-N.
| Molecular formula | C11H12O |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | 4,5-dimethyl-2,3-dihydroinden-1-one |
| InChIKey | YMIIQKHQXYRXGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)CC2)C |
Computed by PubChem (NCBI)