CAS 377-40-2 appears in our catalog under these names: 1,2-Dibromohexafluorocyclobutane, 95%, 1,2-Dibromohexafluorocyclobutane, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 1g.
1,2-dibromo-1,2,3,3,4,4-hexafluorocyclobutane (CAS 377-40-2) is a chemical compound with the molecular formula C4Br2F6 and a molecular weight of 321.84 g/mol. IUPAC name: 1,2-dibromo-1,2,3,3,4,4-hexafluorocyclobutane. InChIKey: HLCPJMKKTKDOGB-UHFFFAOYSA-N.
| Molecular formula | C4Br2F6 |
|---|---|
| Molecular weight | 321.84 g/mol |
| IUPAC name | 1,2-dibromo-1,2,3,3,4,4-hexafluorocyclobutane |
| InChIKey | HLCPJMKKTKDOGB-UHFFFAOYSA-N |
| SMILES | C1(C(C(C1(F)Br)(F)Br)(F)F)(F)F |
Computed by PubChem (NCBI)