CAS 384-51-0 is the registry number for 2,3-Dibromohexafluoro-2-butene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
(E)-2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene (CAS 384-51-0) is a chemical compound with the molecular formula C4Br2F6 and a molecular weight of 321.84 g/mol. IUPAC name: (E)-2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene. InChIKey: AXAMFVOTWJBOCA-OWOJBTEDSA-N.
| Molecular formula | C4Br2F6 |
|---|---|
| Molecular weight | 321.84 g/mol |
| IUPAC name | (E)-2,3-dibromo-1,1,1,4,4,4-hexafluorobut-2-ene |
| InChIKey | AXAMFVOTWJBOCA-OWOJBTEDSA-N |
| SMILES | C(=C(/C(F)(F)F)\Br)(\C(F)(F)F)/Br |
Computed by PubChem (NCBI)