CAS 377051-52-0 is the registry number for 3-(2-Chloro-phenyl)-isoxazole-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(2-chlorophenyl)-1,2-oxazole-5-carbaldehyde (CAS 377051-52-0) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 3-(2-chlorophenyl)-1,2-oxazole-5-carbaldehyde. InChIKey: CJJVDXAJEFUZRU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-1,2-oxazole-5-carbaldehyde |
| InChIKey | CJJVDXAJEFUZRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)C=O)Cl |
Computed by PubChem (NCBI)