Products 377083-80-2

CAS 377083-80-2 appears in our catalog under these names: 3-(3-Fluoro-2-methylphenyl)propionic acid, 3-(3-Fluoro-2-methylphenyl)propionic acid, 95%, 3-(3-Fluoro-2-methylphenyl)propanoic acid, 95+%, 3-(3-fluoro-2-methylphenyl)propanoic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 2,5g, 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

3-(3-fluoro-2-methylphenyl)propanoic acid (CAS 377083-80-2) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 3-(3-fluoro-2-methylphenyl)propanoic acid. InChIKey: ASZYDQYGUZNHFU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FO2
Molecular weight182.19 g/mol
IUPAC name3-(3-fluoro-2-methylphenyl)propanoic acid
InChIKeyASZYDQYGUZNHFU-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1F)CCC(=O)O

Computed by PubChem (NCBI)