CAS 3775-01-7 is the registry number for 5-Benzylidenehydantoin. Offered by: TRC. Available pack sizes: 2,5g.
(5Z)-5-benzylideneimidazolidine-2,4-dione (CAS 3775-01-7) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: (5Z)-5-benzylideneimidazolidine-2,4-dione. InChIKey: UDTSPKADQGPZFS-VURMDHGXSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (5Z)-5-benzylideneimidazolidine-2,4-dione |
| InChIKey | UDTSPKADQGPZFS-VURMDHGXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C\2/C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)