CAS 377756-15-5 appears in our catalog under these names: 4-Bromo Pirfenidone, 1-(4-Bromophenyl)-5-Methyl-2(1H)-Pyridinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
1-(4-bromophenyl)-5-methylpyridin-2-one (CAS 377756-15-5) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 1-(4-bromophenyl)-5-methylpyridin-2-one. InChIKey: PYZJZGLJFOVHRH-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-methylpyridin-2-one |
| InChIKey | PYZJZGLJFOVHRH-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=O)C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)