Products 377769-38-5
CAS 377769-38-5 is the registry number for 4-(4-tert-Butylphenoxymethyl)benzohydrazide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-[(4-tert-butylphenoxy)methyl]benzohydrazide (CAS 377769-38-5) is a chemical compound with the molecular formula C18H22N2O2 and a molecular weight of 298.4 g/mol. IUPAC name: 4-[(4-tert-butylphenoxy)methyl]benzohydrazide. InChIKey: LPTNGRXVDYUBAL-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 4-[(4-tert-butylphenoxy)methyl]benzohydrazide |
| InChIKey | LPTNGRXVDYUBAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC2=CC=C(C=C2)C(=O)NN |
Computed by PubChem (NCBI)