Products 378206-75-8

CAS 378206-75-8 is the registry number for 2,4-Dichloro-5-isobutylsulfamoyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoic acid (CAS 378206-75-8) is a chemical compound with the molecular formula C11H13Cl2NO4S and a molecular weight of 326.2 g/mol. IUPAC name: 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoic acid. InChIKey: SNZSFWOSJFUAFS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13Cl2NO4S
Molecular weight326.2 g/mol
IUPAC name2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoic acid
InChIKeySNZSFWOSJFUAFS-UHFFFAOYSA-N
SMILESCC(C)CNS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)