CAS 95454-00-5 appears in our catalog under these names: 2,4-Dichloro-5-(diethylsulfamoyl)benzoic acid, 2,4-Dichloro-5-[(diethylamino)sulfonyl]benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 250mg, 100mg, 1g.
2,4-dichloro-5-(diethylsulfamoyl)benzoic acid (CAS 95454-00-5) is a chemical compound with the molecular formula C11H13Cl2NO4S and a molecular weight of 326.2 g/mol. IUPAC name: 2,4-dichloro-5-(diethylsulfamoyl)benzoic acid. InChIKey: PJAZEADZNVJRAL-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO4S |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 2,4-dichloro-5-(diethylsulfamoyl)benzoic acid |
| InChIKey | PJAZEADZNVJRAL-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)