Products 95454-00-5

CAS 95454-00-5 appears in our catalog under these names: 2,4-Dichloro-5-(diethylsulfamoyl)benzoic acid, 2,4-Dichloro-5-[(diethylamino)sulfonyl]benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-(diethylsulfamoyl)benzoic acid (CAS 95454-00-5) is a chemical compound with the molecular formula C11H13Cl2NO4S and a molecular weight of 326.2 g/mol. IUPAC name: 2,4-dichloro-5-(diethylsulfamoyl)benzoic acid. InChIKey: PJAZEADZNVJRAL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13Cl2NO4S
Molecular weight326.2 g/mol
IUPAC name2,4-dichloro-5-(diethylsulfamoyl)benzoic acid
InChIKeyPJAZEADZNVJRAL-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)