Products 37874-96-7

CAS 37874-96-7 is the registry number for 4-(Cyclobutylmethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(cyclobutylmethyl)benzoic acid (CAS 37874-96-7) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 4-(cyclobutylmethyl)benzoic acid. InChIKey: ABJNZQLPTZVNCG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O2
Molecular weight190.24 g/mol
IUPAC name4-(cyclobutylmethyl)benzoic acid
InChIKeyABJNZQLPTZVNCG-UHFFFAOYSA-N
SMILESC1CC(C1)CC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)