CAS 379254-98-5 appears in our catalog under these names: 2-Chloro-n-(2-chloro-4-nitro-phenyl)-propionamide, 95%, N-(2-Chloro-4-nitrophenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
2-chloro-N-(2-chloro-4-nitrophenyl)propanamide (CAS 379254-98-5) is a chemical compound with the molecular formula C9H8Cl2N2O3 and a molecular weight of 263.07 g/mol. IUPAC name: 2-chloro-N-(2-chloro-4-nitrophenyl)propanamide. InChIKey: YCFSQPKOKLUQBO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O3 |
|---|---|
| Molecular weight | 263.07 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-4-nitrophenyl)propanamide |
| InChIKey | YCFSQPKOKLUQBO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)