CAS 78466-25-8 is the registry number for Nintedanib Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dichloro-N-methyl-N-(4-nitrophenyl)acetamide (CAS 78466-25-8) is a chemical compound with the molecular formula C9H8Cl2N2O3 and a molecular weight of 263.07 g/mol. IUPAC name: 2,2-dichloro-N-methyl-N-(4-nitrophenyl)acetamide. InChIKey: QDWACLYGJGBTIO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2O3 |
|---|---|
| Molecular weight | 263.07 g/mol |
| IUPAC name | 2,2-dichloro-N-methyl-N-(4-nitrophenyl)acetamide |
| InChIKey | QDWACLYGJGBTIO-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)C(Cl)Cl |
Computed by PubChem (NCBI)