CAS 379255-70-6 appears in our catalog under these names: 3-[(5-Chloro-2,4-dimethoxy-phenyl)-methyl-sulfamoyl]-benzoic acid, 95%, 3-((5-Chloro-2,4-dimethoxyphenyl)(methyl)sulfamoyl)benzoic acid, 95%, 3-((5-Chloro-2,4-dimethoxyphenyl)(methyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]benzoic acid (CAS 379255-70-6) is a chemical compound with the molecular formula C16H16ClNO6S and a molecular weight of 385.8 g/mol. IUPAC name: 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]benzoic acid. InChIKey: XVYFYSPBGXWZGC-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO6S |
|---|---|
| Molecular weight | 385.8 g/mol |
| IUPAC name | 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]benzoic acid |
| InChIKey | XVYFYSPBGXWZGC-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=C(C=C1OC)OC)Cl)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)