CAS 87549-39-1 is the registry number for Fenoldopam 8-Sulfate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 25mg, 10mg, 50mg.
[9-chloro-8-hydroxy-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl] hydrogen sulfate (CAS 87549-39-1) is a chemical compound with the molecular formula C16H16ClNO6S and a molecular weight of 385.8 g/mol. IUPAC name: [9-chloro-8-hydroxy-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl] hydrogen sulfate. InChIKey: KIMBJLCPZPHHRD-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO6S |
|---|---|
| Molecular weight | 385.8 g/mol |
| IUPAC name | [9-chloro-8-hydroxy-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl] hydrogen sulfate |
| InChIKey | KIMBJLCPZPHHRD-UHFFFAOYSA-N |
| SMILES | C1CNCC(C2=CC(=C(C(=C21)Cl)O)OS(=O)(=O)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)