CAS 37945-06-5 appears in our catalog under these names: Estazolam Impurity 1, Estazolam Impurity 6, 5-Chloro-2-(3-chloromethyl-4H-1,2,4-triazol-4-yl)-benzophenone, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-phenylmethanone (CAS 37945-06-5) is a chemical compound with the molecular formula C16H11Cl2N3O and a molecular weight of 332.2 g/mol. IUPAC name: [5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-phenylmethanone. InChIKey: KBWXJZXYNPXORC-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2N3O |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | [5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-phenylmethanone |
| InChIKey | KBWXJZXYNPXORC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)N3C=NN=C3CCl |
Computed by PubChem (NCBI)