CAS 41332-39-2 is the registry number for 3-((2,4-Dichlorobenzylidene)amino)-2-methylquinazolin-4(3H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-methylquinazolin-4-one (CAS 41332-39-2) is a chemical compound with the molecular formula C16H11Cl2N3O and a molecular weight of 332.2 g/mol. IUPAC name: 3-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-methylquinazolin-4-one. InChIKey: ZQUNFFKOKSASBD-DJKKODMXSA-N.
| Molecular formula | C16H11Cl2N3O |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 3-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-methylquinazolin-4-one |
| InChIKey | ZQUNFFKOKSASBD-DJKKODMXSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=O)N1/N=C/C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)