CAS 3796-74-5 appears in our catalog under these names: (1,1'-Biphenyl)-2,6-diol, 97%, 2-Phenylbenzene-1,3-diol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-phenylbenzene-1,3-diol (CAS 3796-74-5) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 2-phenylbenzene-1,3-diol. InChIKey: UPXZHXVOMCGZDS-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-phenylbenzene-1,3-diol |
| InChIKey | UPXZHXVOMCGZDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=C2O)O |
Computed by PubChem (NCBI)