CAS 37991-40-5 is the registry number for Dichlorobis(2,4-dimethylpyridine)palladium, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Dichloropalladium;bis(2,4-dimethylpyridine) (CAS 37991-40-5) is a chemical compound with the molecular formula C14H18Cl2N2Pd and a molecular weight of 391.6 g/mol. IUPAC name: dichloropalladium;bis(2,4-dimethylpyridine). InChIKey: XBAAWIWIMABHMB-UHFFFAOYSA-L.
| Molecular formula | C14H18Cl2N2Pd |
|---|---|
| Molecular weight | 391.6 g/mol |
| IUPAC name | dichloropalladium;bis(2,4-dimethylpyridine) |
| InChIKey | XBAAWIWIMABHMB-UHFFFAOYSA-L |
| SMILES | CC1=CC(=NC=C1)C.CC1=CC(=NC=C1)C.Cl[Pd]Cl |
Computed by PubChem (NCBI)