CAS 55126-74-4 is the registry number for Dichlorobis(benzylamine) palladium(II), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dichloropalladium;phenylmethanamine (CAS 55126-74-4) is a chemical compound with the molecular formula C14H18Cl2N2Pd and a molecular weight of 391.6 g/mol. IUPAC name: dichloropalladium;phenylmethanamine. InChIKey: DZGZTKMCZIWUKX-UHFFFAOYSA-L.
| Molecular formula | C14H18Cl2N2Pd |
|---|---|
| Molecular weight | 391.6 g/mol |
| IUPAC name | dichloropalladium;phenylmethanamine |
| InChIKey | DZGZTKMCZIWUKX-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)CN.C1=CC=C(C=C1)CN.Cl[Pd]Cl |
Computed by PubChem (NCBI)