CAS 380341-80-0 is the registry number for 2,4-Dichloro-5-((4-ethoxyphenyl)sulfamoyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,4-dichloro-5-[(4-ethoxyphenyl)sulfamoyl]benzoic acid (CAS 380341-80-0) is a chemical compound with the molecular formula C15H13Cl2NO5S and a molecular weight of 390.2 g/mol. IUPAC name: 2,4-dichloro-5-[(4-ethoxyphenyl)sulfamoyl]benzoic acid. InChIKey: UBECYVCXPYMEHH-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO5S |
|---|---|
| Molecular weight | 390.2 g/mol |
| IUPAC name | 2,4-dichloro-5-[(4-ethoxyphenyl)sulfamoyl]benzoic acid |
| InChIKey | UBECYVCXPYMEHH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)