Products 380341-80-0

CAS 380341-80-0 is the registry number for 2,4-Dichloro-5-((4-ethoxyphenyl)sulfamoyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-[(4-ethoxyphenyl)sulfamoyl]benzoic acid (CAS 380341-80-0) is a chemical compound with the molecular formula C15H13Cl2NO5S and a molecular weight of 390.2 g/mol. IUPAC name: 2,4-dichloro-5-[(4-ethoxyphenyl)sulfamoyl]benzoic acid. InChIKey: UBECYVCXPYMEHH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13Cl2NO5S
Molecular weight390.2 g/mol
IUPAC name2,4-dichloro-5-[(4-ethoxyphenyl)sulfamoyl]benzoic acid
InChIKeyUBECYVCXPYMEHH-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)NS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)