CAS 750613-66-2 appears in our catalog under these names: 2,4-Dichloro-5-(2-methoxy-benzylsulfamoyl)-benzoic acid, 95%, 2,4-Dichloro-5-{((2-methoxyphenyl)methyl)sulfamoyl}benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,4-dichloro-5-[(2-methoxyphenyl)methylsulfamoyl]benzoic acid (CAS 750613-66-2) is a chemical compound with the molecular formula C15H13Cl2NO5S and a molecular weight of 390.2 g/mol. IUPAC name: 2,4-dichloro-5-[(2-methoxyphenyl)methylsulfamoyl]benzoic acid. InChIKey: AFTCIYJXQXSRKY-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO5S |
|---|---|
| Molecular weight | 390.2 g/mol |
| IUPAC name | 2,4-dichloro-5-[(2-methoxyphenyl)methylsulfamoyl]benzoic acid |
| InChIKey | AFTCIYJXQXSRKY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1CNS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)