CAS 380342-93-8 is the registry number for 4-Chloro-3-(2,3-dihydro-1H-indole-1-sulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid (CAS 380342-93-8) is a chemical compound with the molecular formula C15H12ClNO4S and a molecular weight of 337.8 g/mol. IUPAC name: 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid. InChIKey: IVMIMSXDLXNILK-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO4S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid |
| InChIKey | IVMIMSXDLXNILK-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)C3=C(C=CC(=C3)C(=O)O)Cl |
Computed by PubChem (NCBI)