Products 380342-93-8

CAS 380342-93-8 is the registry number for 4-Chloro-3-(2,3-dihydro-1H-indole-1-sulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid (CAS 380342-93-8) is a chemical compound with the molecular formula C15H12ClNO4S and a molecular weight of 337.8 g/mol. IUPAC name: 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid. InChIKey: IVMIMSXDLXNILK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12ClNO4S
Molecular weight337.8 g/mol
IUPAC name4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid
InChIKeyIVMIMSXDLXNILK-UHFFFAOYSA-N
SMILESC1CN(C2=CC=CC=C21)S(=O)(=O)C3=C(C=CC(=C3)C(=O)O)Cl

Computed by PubChem (NCBI)