Products 380345-39-1
CAS 380345-39-1 is the registry number for 2-Chloro-n-(4-chloro-2-fluorophenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-chloro-N-(4-chloro-2-fluorophenyl)acetamide (CAS 380345-39-1) is a chemical compound with the molecular formula C8H6Cl2FNO and a molecular weight of 222.04 g/mol. IUPAC name: 2-chloro-N-(4-chloro-2-fluorophenyl)acetamide. InChIKey: XTYTUPVHQHMXCF-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2FNO |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 2-chloro-N-(4-chloro-2-fluorophenyl)acetamide |
| InChIKey | XTYTUPVHQHMXCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)NC(=O)CCl |
Computed by PubChem (NCBI)