Products 855715-22-9
CAS 855715-22-9 appears in our catalog under these names: 2-Chloro-n-(5-chloro-2-fluorophenyl)acetamide, 95%, 2-Chloro-N-(5-chloro-2-fluorophenyl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 2,5g.
2-chloro-N-(5-chloro-2-fluorophenyl)acetamide (CAS 855715-22-9) is a chemical compound with the molecular formula C8H6Cl2FNO and a molecular weight of 222.04 g/mol. IUPAC name: 2-chloro-N-(5-chloro-2-fluorophenyl)acetamide. InChIKey: RXESGMAGKJETDA-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2FNO |
|---|---|
| Molecular weight | 222.04 g/mol |
| IUPAC name | 2-chloro-N-(5-chloro-2-fluorophenyl)acetamide |
| InChIKey | RXESGMAGKJETDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)NC(=O)CCl)F |
Computed by PubChem (NCBI)