CAS 380345-91-5 is the registry number for 5-(2,4-Dichlorophenyl)-4-(2-(propan-2-yl)phenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-(2,4-dichlorophenyl)-4-(2-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione (CAS 380345-91-5) is a chemical compound with the molecular formula C17H15Cl2N3S and a molecular weight of 364.3 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-4-(2-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: BRSFRUJQCNSUKH-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2N3S |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-4-(2-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | BRSFRUJQCNSUKH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1N2C(=NNC2=S)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)