CAS 405068-29-3 is the registry number for ((2,4-dichlorophenyl)amino)((2-indol-3-ylethyl)amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
1-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]thiourea (CAS 405068-29-3) is a chemical compound with the molecular formula C17H15Cl2N3S and a molecular weight of 364.3 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]thiourea. InChIKey: VADXKBJLAGFANN-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2N3S |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]thiourea |
| InChIKey | VADXKBJLAGFANN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=S)NC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)