CAS 380348-54-9 is the registry number for 4-((Quinolin-8-yloxy)methyl)benzohydrazide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-(quinolin-8-yloxymethyl)benzohydrazide (CAS 380348-54-9) is a chemical compound with the molecular formula C17H15N3O2 and a molecular weight of 293.32 g/mol. IUPAC name: 4-(quinolin-8-yloxymethyl)benzohydrazide. InChIKey: GZEPGQARAYQUPR-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O2 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | 4-(quinolin-8-yloxymethyl)benzohydrazide |
| InChIKey | GZEPGQARAYQUPR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OCC3=CC=C(C=C3)C(=O)NN)N=CC=C2 |
Computed by PubChem (NCBI)