CAS 380424-52-2 appears in our catalog under these names: 1-((3,5-Dichlorophenyl)methyl)piperidin-4-amine, 98%, 1-((3,5-Dichlorophenyl)methyl)piperidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[(3,5-dichlorophenyl)methyl]piperidin-4-amine (CAS 380424-52-2) is a chemical compound with the molecular formula C12H16Cl2N2 and a molecular weight of 259.17 g/mol. IUPAC name: 1-[(3,5-dichlorophenyl)methyl]piperidin-4-amine. InChIKey: PCGNHOFWOUARPN-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | 1-[(3,5-dichlorophenyl)methyl]piperidin-4-amine |
| InChIKey | PCGNHOFWOUARPN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)CC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)