CAS 61944-71-6 is the registry number for 1-(2,4-Dichlorobenzyl)-1,4-diazepane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2,4-dichlorophenyl)methyl]-1,4-diazepane (CAS 61944-71-6) is a chemical compound with the molecular formula C12H16Cl2N2 and a molecular weight of 259.17 g/mol. IUPAC name: 1-[(2,4-dichlorophenyl)methyl]-1,4-diazepane. InChIKey: IHNFDVDZXLBUJB-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methyl]-1,4-diazepane |
| InChIKey | IHNFDVDZXLBUJB-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)CC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)