CAS 380435-06-3 is the registry number for 2-(({imidazo(1,2-a)pyridin-2-yl}methyl)sulfanyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoic acid (CAS 380435-06-3) is a chemical compound with the molecular formula C15H12N2O2S and a molecular weight of 284.3 g/mol. IUPAC name: 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoic acid. InChIKey: CBAVIAGQTYCOIL-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2S |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoic acid |
| InChIKey | CBAVIAGQTYCOIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SCC2=CN3C=CC=CC3=N2 |
Computed by PubChem (NCBI)