CAS 618382-78-8 appears in our catalog under these names: 3-(Thiophen-2-yl)-1-p-tolyl-1h-pyrazole-5-carboxylic acid, 95%, 3-Thiophen-2-yl-1-p-tolyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1-(4-methylphenyl)-3-thiophen-2-ylpyrazole-5-carboxylic acid (CAS 618382-78-8) is a chemical compound with the molecular formula C15H12N2O2S and a molecular weight of 284.3 g/mol. IUPAC name: 1-(4-methylphenyl)-3-thiophen-2-ylpyrazole-5-carboxylic acid. InChIKey: AYTZYVJMWLADLK-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2S |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)-3-thiophen-2-ylpyrazole-5-carboxylic acid |
| InChIKey | AYTZYVJMWLADLK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C3=CC=CS3)C(=O)O |
Computed by PubChem (NCBI)