CAS 380436-74-8 appears in our catalog under these names: 3-[Allyl-(2-chloro-phenyl)-sulfamoyl]-4-chloro-benzoic acid, 95%, 4-Chloro-3-((2-chlorophenyl)(prop-2-en-1-yl)sulfamoyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoic acid (CAS 380436-74-8) is a chemical compound with the molecular formula C16H13Cl2NO4S and a molecular weight of 386.2 g/mol. IUPAC name: 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoic acid. InChIKey: SQTPYGXPLLJJCT-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO4S |
|---|---|
| Molecular weight | 386.2 g/mol |
| IUPAC name | 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoic acid |
| InChIKey | SQTPYGXPLLJJCT-UHFFFAOYSA-N |
| SMILES | C=CCN(C1=CC=CC=C1Cl)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)