CAS 726157-10-4 is the registry number for 3-[Allyl-(4-chloro-phenyl)-sulfamoyl]-4-chloro-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoic acid (CAS 726157-10-4) is a chemical compound with the molecular formula C16H13Cl2NO4S and a molecular weight of 386.2 g/mol. IUPAC name: 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoic acid. InChIKey: DCBLWRXMEUMKIG-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO4S |
|---|---|
| Molecular weight | 386.2 g/mol |
| IUPAC name | 4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoic acid |
| InChIKey | DCBLWRXMEUMKIG-UHFFFAOYSA-N |
| SMILES | C=CCN(C1=CC=C(C=C1)Cl)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)