CAS 380442-20-6 appears in our catalog under these names: 3-Amino-n-(3-bromo-4-ethoxy-phenyl)-4-methoxy-benzenesulfonamide, 95%, 3-Amino-N-(3-bromo-4-ethoxyphenyl)-4-methoxybenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-amino-N-(3-bromo-4-ethoxyphenyl)-4-methoxybenzenesulfonamide (CAS 380442-20-6) is a chemical compound with the molecular formula C15H17BrN2O4S and a molecular weight of 401.3 g/mol. IUPAC name: 3-amino-N-(3-bromo-4-ethoxyphenyl)-4-methoxybenzenesulfonamide. InChIKey: SMHXXZNWOSBTPP-UHFFFAOYSA-N.
| Molecular formula | C15H17BrN2O4S |
|---|---|
| Molecular weight | 401.3 g/mol |
| IUPAC name | 3-amino-N-(3-bromo-4-ethoxyphenyl)-4-methoxybenzenesulfonamide |
| InChIKey | SMHXXZNWOSBTPP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)OC)N)Br |
Computed by PubChem (NCBI)