CAS 438031-69-7 is the registry number for 5-Amino-n-(3-bromo-4-ethoxyphenyl)-2-methoxybenzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-amino-N-(3-bromo-4-ethoxyphenyl)-2-methoxybenzenesulfonamide (CAS 438031-69-7) is a chemical compound with the molecular formula C15H17BrN2O4S and a molecular weight of 401.3 g/mol. IUPAC name: 5-amino-N-(3-bromo-4-ethoxyphenyl)-2-methoxybenzenesulfonamide. InChIKey: YJQRIOMALFYHQI-UHFFFAOYSA-N.
| Molecular formula | C15H17BrN2O4S |
|---|---|
| Molecular weight | 401.3 g/mol |
| IUPAC name | 5-amino-N-(3-bromo-4-ethoxyphenyl)-2-methoxybenzenesulfonamide |
| InChIKey | YJQRIOMALFYHQI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)NS(=O)(=O)C2=C(C=CC(=C2)N)OC)Br |
Computed by PubChem (NCBI)