CAS 380584-27-0 appears in our catalog under these names: 2-(3-Chloro-4-methoxyphenyl)-2h-1,2,3-benzotriazol-5-amine, 95%, 2-(3-Chloro-4-methoxyphenyl)-2H-benzo(d)(1,2,3)triazol-5-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-chloro-4-methoxyphenyl)benzotriazol-5-amine (CAS 380584-27-0) is a chemical compound with the molecular formula C13H11ClN4O and a molecular weight of 274.70 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)benzotriazol-5-amine. InChIKey: OXCYKAHSAZUSBK-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4O |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxyphenyl)benzotriazol-5-amine |
| InChIKey | OXCYKAHSAZUSBK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2N=C3C=CC(=CC3=N2)N)Cl |
Computed by PubChem (NCBI)