CAS 648427-11-6 is the registry number for 5-(5-Chloro-1-methyl-1H-pyrazol-4-yl)-3-(p-tolyl)-1,2,4-oxadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5-chloro-1-methylpyrazol-4-yl)-3-(4-methylphenyl)-1,2,4-oxadiazole (CAS 648427-11-6) is a chemical compound with the molecular formula C13H11ClN4O and a molecular weight of 274.70 g/mol. IUPAC name: 5-(5-chloro-1-methylpyrazol-4-yl)-3-(4-methylphenyl)-1,2,4-oxadiazole. InChIKey: ABPUASARAIQVEJ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4O |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 5-(5-chloro-1-methylpyrazol-4-yl)-3-(4-methylphenyl)-1,2,4-oxadiazole |
| InChIKey | ABPUASARAIQVEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)C3=C(N(N=C3)C)Cl |
Computed by PubChem (NCBI)