Products 380636-49-7
CAS 380636-49-7 appears in our catalog under these names: 5-Hydroxymethyl Tolterodine Formate, (R)-5-Hydroxymethyl Tolterodine Formate, 5–hydroxymethyl Tolterodine (formate), 5-Hydroxymethyl tolterodine (formate). Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 50mg, 1mg, Get quote.
2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol;formic acid (CAS 380636-49-7) is a chemical compound with the molecular formula C23H33NO4 and a molecular weight of 387.5 g/mol. IUPAC name: 2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol;formic acid. InChIKey: YXSFRJSZLSBBRR-VEIFNGETSA-N.
| Molecular formula | C23H33NO4 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol;formic acid |
| InChIKey | YXSFRJSZLSBBRR-VEIFNGETSA-N |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)CO)O)C(C)C.C(=O)O |
Computed by PubChem (NCBI)