CAS 94749-02-7 appears in our catalog under these names: Salmeterol EP Impurity B, Salmeterol-phenylethoxy Impurity (USP), Salmeterol EP Impurity B, Salmeterol Impurity 3(Salmeterol EP Impurity B ), 4-Hydroxy-Alpha1-(((6-(2-phenylethoxy)hexyl)amino)methyl)-1,3-benzenedimethanol, (1RS)-1-(4-Hydroxy-3-(hydroxymethyl)phenyl)-2-((6-(2-phenylethoxy)hexyl)amino)ethanol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(2-phenylethoxy)hexylamino]ethyl]phenol (CAS 94749-02-7) is a chemical compound with the molecular formula C23H33NO4 and a molecular weight of 387.5 g/mol. IUPAC name: 2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(2-phenylethoxy)hexylamino]ethyl]phenol. InChIKey: SFLNGSUKAXWYTL-UHFFFAOYSA-N.
| Molecular formula | C23H33NO4 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(2-phenylethoxy)hexylamino]ethyl]phenol |
| InChIKey | SFLNGSUKAXWYTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCOCCCCCCNCC(C2=CC(=C(C=C2)O)CO)O |
Computed by PubChem (NCBI)