CAS 3807-58-7 is the registry number for 1-(4-Methoxyphenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g.
1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid (CAS 3807-58-7) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: JPCJXGCPGGBFCU-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| InChIKey | JPCJXGCPGGBFCU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)OC)C)C(=O)O |
Computed by PubChem (NCBI)