CAS 38072-53-6 is the registry number for (Z)- Disperse Yellow 39. Offered by: TRC. Available pack sizes: 1g, 2,5g, 250mg.
(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-1H-indol-3-one (CAS 38072-53-6) is a chemical compound with the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. IUPAC name: (2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-1H-indol-3-one. InChIKey: QHKZIUJTLUGSEX-WJDWOHSUSA-N.
| Molecular formula | C17H16N2O |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-1H-indol-3-one |
| InChIKey | QHKZIUJTLUGSEX-WJDWOHSUSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C\2/C(=O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)