Products 38120-54-6

CAS 38120-54-6 is the registry number for 2-((2-Chlorophenyl)amino)-3-nitrobenzoic Acid. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.

Structural formula: {0} (CAS {1})

2-(2-chloroanilino)-3-nitrobenzoic acid (CAS 38120-54-6) is a chemical compound with the molecular formula C13H9ClN2O4 and a molecular weight of 292.67 g/mol. IUPAC name: 2-(2-chloroanilino)-3-nitrobenzoic acid. InChIKey: RBSLDBOPQNICON-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9ClN2O4
Molecular weight292.67 g/mol
IUPAC name2-(2-chloroanilino)-3-nitrobenzoic acid
InChIKeyRBSLDBOPQNICON-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)NC2=C(C=CC=C2[N+](=O)[O-])C(=O)O)Cl

Computed by PubChem (NCBI)