Products 99434-90-9
CAS 99434-90-9 is the registry number for ADN 138. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chlorospiro[9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-3,3'-pyrrolidine]-2,2',5'-trione (CAS 99434-90-9) is a chemical compound with the molecular formula C13H9ClN2O4 and a molecular weight of 292.67 g/mol. IUPAC name: 6-chlorospiro[9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-3,3'-pyrrolidine]-2,2',5'-trione. InChIKey: WSLOHMLGIVSUPR-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O4 |
|---|---|
| Molecular weight | 292.67 g/mol |
| IUPAC name | 6-chlorospiro[9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-3,3'-pyrrolidine]-2,2',5'-trione |
| InChIKey | WSLOHMLGIVSUPR-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=CC3=C2N1C(=O)C34CC(=O)NC4=O)Cl |
Computed by PubChem (NCBI)