CAS 381233-79-0 appears in our catalog under these names: 3–bromo–5–(2–pyridyl)–1,2–dihydropyridin–2–one, 5′-Bromo[2,3′-bipyridin]-6′(1′H)-one, [2,3'-Bipyridin]-6'(1'H)-one, 5'-bromo-, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg.
3-bromo-5-pyridin-2-yl-1H-pyridin-2-one (CAS 381233-79-0) is a chemical compound with the molecular formula C10H7BrN2O and a molecular weight of 251.08 g/mol. IUPAC name: 3-bromo-5-pyridin-2-yl-1H-pyridin-2-one. InChIKey: PEQPGOOJLLJRPM-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 3-bromo-5-pyridin-2-yl-1H-pyridin-2-one |
| InChIKey | PEQPGOOJLLJRPM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CNC(=O)C(=C2)Br |
Computed by PubChem (NCBI)